C24H30N4O3 — CID 171556367
N-[3-[(2E,4Z,6Z)-6-[(Z)-C-ethyl-N-hydroxycarbonimidoyl]-4,7-dimethylnona-2,4,6-trien-3-yl]-1-methyl-2-oxo-1,6-naphthyridin-7-yl]formamide (PubChem CID 171556367) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[3-[(2E,4Z,6Z)-6-[(Z)-C-ethyl-N-hydroxycarbonimidoyl]-4,7-dimethylnona-2,4,6-trien-3-yl]-1-methyl-2-oxo-1,6-naphthyridin-7-yl]formamide.
| Compound Name | N-[3-[(2E,4Z,6Z)-6-[(Z)-C-ethyl-N-hydroxycarbonimidoyl]-4,7-dimethylnona-2,4,6-trien-3-yl]-1-methyl-2-oxo-1,6-naphthyridin-7-yl]formamide |
|---|---|
| PubChem CID | 171556367 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | N-[3-[(2E,4Z,6Z)-6-[(Z)-C-ethyl-N-hydroxycarbonimidoyl]-4,7-dimethylnona-2,4,6-trien-3-yl]-1-methyl-2-oxo-1,6-naphthyridin-7-yl]formamide |
| SMILES | C/C=C(C(\C)=C/C(/C(CC)=N\O)=C(\C)CC)/c1cc2cnc(NC=O)cc2n(C)c1=O |
| InChI | InChI=1S/C24H30N4O3/c1-7-15(4)19(21(9-3)27-31)10-16(5)18(8-2)20-11-17-13-25-23(26-14-29)12-22(17)28(6)24(20)30/h8,10-14,31H,7,9H2,1-6H3,(H,25,26,29)/b16-10-,18-8+,19-15-,27-21- |
| InChIKey | SYXYAPYQUCDRLF-GWTUQBGCSA-N |
| XLogP | 4.82 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|