C25H33N3O2S — CID 171556174
cyclopropane;N-[7-[(2E,4Z,6Z)-6-(1-hydroxy-2-methylsulfanylethyl)-4-methylnona-2,4,6-trien-3-yl]-2,6-naphthyridin-3-yl]formamide (PubChem CID 171556174) has the molecular formula C25H33N3O2S and a molecular weight of 439.63 g/mol. Its IUPAC name is cyclopropane;N-[7-[(2E,4Z,6Z)-6-(1-hydroxy-2-methylsulfanylethyl)-4-methylnona-2,4,6-trien-3-yl]-2,6-naphthyridin-3-yl]formamide.
| Compound Name | cyclopropane;N-[7-[(2E,4Z,6Z)-6-(1-hydroxy-2-methylsulfanylethyl)-4-methylnona-2,4,6-trien-3-yl]-2,6-naphthyridin-3-yl]formamide |
|---|---|
| PubChem CID | 171556174 |
| Molecular Formula | C25H33N3O2S |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | cyclopropane;N-[7-[(2E,4Z,6Z)-6-(1-hydroxy-2-methylsulfanylethyl)-4-methylnona-2,4,6-trien-3-yl]-2,6-naphthyridin-3-yl]formamide |
| SMILES | C/C=C(C(\C)=C/C(=C/CC)C(O)CSC)/c1cc2cnc(NC=O)cc2cn1.C1CC1 |
| InChI | InChI=1S/C22H27N3O2S.C3H6/c1-5-7-16(21(27)13-28-4)8-15(3)19(6-2)20-9-17-12-24-22(25-14-26)10-18(17)11-23-20;1-2-3-1/h6-12,14,21,27H,5,13H2,1-4H3,(H,24,25,26);1-3H2/b15-8-,16-7-,19-6+; |
| InChIKey | ANGGIGGASWHVDK-SBNVQEESSA-N |
| XLogP | 5.78 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|