C31H43N3O — CID 171555284
bicyclo[1.1.1]pentane;ethane;N-[7-[(2E,4Z)-4-methylnona-2,4-dien-3-yl]-2,6-naphthyridin-3-yl]bicyclo[1.1.1]pentane-1-carboxamide (PubChem CID 171555284) has the molecular formula C31H43N3O and a molecular weight of 473.71 g/mol. Its IUPAC name is bicyclo[1.1.1]pentane;ethane;N-[7-[(2E,4Z)-4-methylnona-2,4-dien-3-yl]-2,6-naphthyridin-3-yl]bicyclo[1.1.1]pentane-1-carboxamide.
| Compound Name | bicyclo[1.1.1]pentane;ethane;N-[7-[(2E,4Z)-4-methylnona-2,4-dien-3-yl]-2,6-naphthyridin-3-yl]bicyclo[1.1.1]pentane-1-carboxamide |
|---|---|
| PubChem CID | 171555284 |
| Molecular Formula | C31H43N3O |
| Molecular Weight | 473.71 g/mol |
| Exact Mass | 473.34 |
| IUPAC Name | bicyclo[1.1.1]pentane;ethane;N-[7-[(2E,4Z)-4-methylnona-2,4-dien-3-yl]-2,6-naphthyridin-3-yl]bicyclo[1.1.1]pentane-1-carboxamide |
| SMILES | C/C=C(C(\C)=C/CCCC)/c1cc2cnc(NC(=O)C34CC(C3)C4)cc2cn1.C1C2CC1C2.CC |
| InChI | InChI=1S/C24H29N3O.C5H8.C2H6/c1-4-6-7-8-16(3)20(5-2)21-9-18-15-26-22(10-19(18)14-25-21)27-23(28)24-11-17(12-24)13-24;1-4-2-5(1)3-4;1-2/h5,8-10,14-15,17H,4,6-7,11-13H2,1-3H3,(H,26,27,28);4-5H,1-3H2;1-2H3/b16-8-,20-5+;; |
| InChIKey | XRLAUZFVKDZVDG-FSQPLQGDSA-N |
| XLogP | 8.35 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.71 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|