C25H30FN3O2S — CID 171555953
2-fluoro-N-[7-[(2E,4Z,6Z)-6-(1-hydroxy-2-methylsulfanylethyl)-4-methylnona-2,4,6-trien-3-yl]-2,6-naphthyridin-3-yl]cyclopropane-1-carboxamide (PubChem CID 171555953) has the molecular formula C25H30FN3O2S and a molecular weight of 455.60 g/mol. Its IUPAC name is 2-fluoro-N-[7-[(2E,4Z,6Z)-6-(1-hydroxy-2-methylsulfanylethyl)-4-methylnona-2,4,6-trien-3-yl]-2,6-naphthyridin-3-yl]cyclopropane-1-carboxamide.
| Compound Name | 2-fluoro-N-[7-[(2E,4Z,6Z)-6-(1-hydroxy-2-methylsulfanylethyl)-4-methylnona-2,4,6-trien-3-yl]-2,6-naphthyridin-3-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 171555953 |
| Molecular Formula | C25H30FN3O2S |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 2-fluoro-N-[7-[(2E,4Z,6Z)-6-(1-hydroxy-2-methylsulfanylethyl)-4-methylnona-2,4,6-trien-3-yl]-2,6-naphthyridin-3-yl]cyclopropane-1-carboxamide |
| SMILES | C/C=C(C(\C)=C/C(=C/CC)C(O)CSC)/c1cc2cnc(NC(=O)C3CC3F)cc2cn1 |
| InChI | InChI=1S/C25H30FN3O2S/c1-5-7-16(23(30)14-32-4)8-15(3)19(6-2)22-9-17-13-28-24(10-18(17)12-27-22)29-25(31)20-11-21(20)26/h6-10,12-13,20-21,23,30H,5,11,14H2,1-4H3,(H,28,29,31)/b15-8-,16-7-,19-6+ |
| InChIKey | FGBVUDHMMVAHRW-IOXWRWDSSA-N |
| XLogP | 5.34 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|