C25H31N3O2 — CID 171555303
N-[7-[(2E,4Z,6Z)-6-(1-hydroxycyclobutyl)-4,7-dimethylnona-2,4,6-trien-3-yl]-2,6-naphthyridin-3-yl]acetamide (PubChem CID 171555303) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-[7-[(2E,4Z,6Z)-6-(1-hydroxycyclobutyl)-4,7-dimethylnona-2,4,6-trien-3-yl]-2,6-naphthyridin-3-yl]acetamide.
| Compound Name | N-[7-[(2E,4Z,6Z)-6-(1-hydroxycyclobutyl)-4,7-dimethylnona-2,4,6-trien-3-yl]-2,6-naphthyridin-3-yl]acetamide |
|---|---|
| PubChem CID | 171555303 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | N-[7-[(2E,4Z,6Z)-6-(1-hydroxycyclobutyl)-4,7-dimethylnona-2,4,6-trien-3-yl]-2,6-naphthyridin-3-yl]acetamide |
| SMILES | C/C=C(C(\C)=C/C(=C(\C)CC)C1(O)CCC1)/c1cc2cnc(NC(C)=O)cc2cn1 |
| InChI | InChI=1S/C25H31N3O2/c1-6-16(3)22(25(30)9-8-10-25)11-17(4)21(7-2)23-12-19-15-27-24(28-18(5)29)13-20(19)14-26-23/h7,11-15,30H,6,8-10H2,1-5H3,(H,27,28,29)/b17-11-,21-7+,22-16- |
| InChIKey | GNNQPPHOAMVQCU-POQKVTPZSA-N |
| XLogP | 5.58 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|