C27H31N3O2 — CID 171555854
N-[5-cyclopropyl-7-[(2E,4Z)-4-methyl-6-methylidene-7-oxodeca-2,4-dien-3-yl]-2,6-naphthyridin-3-yl]cyclopropanecarboxamide (PubChem CID 171555854) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is N-[5-cyclopropyl-7-[(2E,4Z)-4-methyl-6-methylidene-7-oxodeca-2,4-dien-3-yl]-2,6-naphthyridin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[5-cyclopropyl-7-[(2E,4Z)-4-methyl-6-methylidene-7-oxodeca-2,4-dien-3-yl]-2,6-naphthyridin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 171555854 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | N-[5-cyclopropyl-7-[(2E,4Z)-4-methyl-6-methylidene-7-oxodeca-2,4-dien-3-yl]-2,6-naphthyridin-3-yl]cyclopropanecarboxamide |
| SMILES | C=C(/C=C(C)\C(=C/C)c1cc2cnc(NC(=O)C3CC3)cc2c(C2CC2)n1)C(=O)CCC |
| InChI | InChI=1S/C27H31N3O2/c1-5-7-24(31)17(4)12-16(3)21(6-2)23-13-20-15-28-25(30-27(32)19-10-11-19)14-22(20)26(29-23)18-8-9-18/h6,12-15,18-19H,4-5,7-11H2,1-3H3,(H,28,30,32)/b16-12-,21-6+ |
| InChIKey | NOVBXKJQPCHAJB-PNTBXUJVSA-N |
| XLogP | 6.13 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|