C24H29ClN2O — CID 171555089
(5Z,6Z,8E)-5-butan-2-ylidene-8-(7-chloro-1-methyl-2,6-naphthyridin-3-yl)-7-methyldeca-6,8-dien-4-one (PubChem CID 171555089) has the molecular formula C24H29ClN2O and a molecular weight of 396.96 g/mol. Its IUPAC name is (5Z,6Z,8E)-5-butan-2-ylidene-8-(7-chloro-1-methyl-2,6-naphthyridin-3-yl)-7-methyldeca-6,8-dien-4-one.
| Compound Name | (5Z,6Z,8E)-5-butan-2-ylidene-8-(7-chloro-1-methyl-2,6-naphthyridin-3-yl)-7-methyldeca-6,8-dien-4-one |
|---|---|
| PubChem CID | 171555089 |
| Molecular Formula | C24H29ClN2O |
| Molecular Weight | 396.96 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (5Z,6Z,8E)-5-butan-2-ylidene-8-(7-chloro-1-methyl-2,6-naphthyridin-3-yl)-7-methyldeca-6,8-dien-4-one |
| SMILES | C/C=C(C(\C)=C/C(C(=O)CCC)=C(\C)CC)/c1cc2cnc(Cl)cc2c(C)n1 |
| InChI | InChI=1S/C24H29ClN2O/c1-7-10-23(28)20(15(4)8-2)11-16(5)19(9-3)22-12-18-14-26-24(25)13-21(18)17(6)27-22/h9,11-14H,7-8,10H2,1-6H3/b16-11-,19-9+,20-15- |
| InChIKey | XCOYHRNEDAFDJC-HICIOPSESA-N |
| XLogP | 7.04 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.96 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|