C8H5ClN4O3 — CID 138108793
1-(5-chloro-3-nitropyrazolo[3,4-c]pyridin-1-yl)ethanone (PubChem CID 138108793) has the molecular formula C8H5ClN4O3 and a molecular weight of 240.61 g/mol. Its IUPAC name is 1-(5-chloro-3-nitropyrazolo[3,4-c]pyridin-1-yl)ethanone.
| Compound Name | 1-(5-chloro-3-nitropyrazolo[3,4-c]pyridin-1-yl)ethanone |
|---|---|
| PubChem CID | 138108793 |
| Molecular Formula | C8H5ClN4O3 |
| Molecular Weight | 240.61 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 1-(5-chloro-3-nitropyrazolo[3,4-c]pyridin-1-yl)ethanone |
| SMILES | CC(=O)n1nc([N+](=O)[O-])c2cc(Cl)ncc21 |
| InChI | InChI=1S/C8H5ClN4O3/c1-4(14)12-6-3-10-7(9)2-5(6)8(11-12)13(15)16/h2-3H,1H3 |
| InChIKey | KFOLUUWOMUVYAR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.61 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|