C8H5ClN4 — CID 170700378
5-chloro-1-methylpyrazolo[3,4-c]pyridine-3-carbonitrile (PubChem CID 170700378) has the molecular formula C8H5ClN4 and a molecular weight of 192.61 g/mol. Its IUPAC name is 5-chloro-1-methylpyrazolo[3,4-c]pyridine-3-carbonitrile.
| Compound Name | 5-chloro-1-methylpyrazolo[3,4-c]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 170700378 |
| Molecular Formula | C8H5ClN4 |
| Molecular Weight | 192.61 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | 5-chloro-1-methylpyrazolo[3,4-c]pyridine-3-carbonitrile |
| SMILES | Cn1nc(C#N)c2cc(Cl)ncc21 |
| InChI | InChI=1S/C8H5ClN4/c1-13-7-4-11-8(9)2-5(7)6(3-10)12-13/h2,4H,1H3 |
| InChIKey | IAQZEGXDAFAEGU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.61 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|