C25H32ClNO — CID 171555927
(3Z,4Z,6E,7E,8E)-3-butan-2-ylidene-7-[(6-chloro-4-methyl-3-pyridinyl)methylidene]-6-ethylidene-5-methylundeca-4,8-dien-2-one (PubChem CID 171555927) has the molecular formula C25H32ClNO and a molecular weight of 397.99 g/mol. Its IUPAC name is (3Z,4Z,6E,7E,8E)-3-butan-2-ylidene-7-[(6-chloro-4-methyl-3-pyridinyl)methylidene]-6-ethylidene-5-methylundeca-4,8-dien-2-one.
| Compound Name | (3Z,4Z,6E,7E,8E)-3-butan-2-ylidene-7-[(6-chloro-4-methyl-3-pyridinyl)methylidene]-6-ethylidene-5-methylundeca-4,8-dien-2-one |
|---|---|
| PubChem CID | 171555927 |
| Molecular Formula | C25H32ClNO |
| Molecular Weight | 397.99 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | (3Z,4Z,6E,7E,8E)-3-butan-2-ylidene-7-[(6-chloro-4-methyl-3-pyridinyl)methylidene]-6-ethylidene-5-methylundeca-4,8-dien-2-one |
| SMILES | C/C=C(C(\C)=C\C(C(C)=O)=C(/C)CC)/C(/C=C/CC)=C/c1cnc(Cl)cc1C |
| InChI | InChI=1S/C25H32ClNO/c1-8-11-12-21(15-22-16-27-25(26)14-18(22)5)23(10-3)19(6)13-24(20(7)28)17(4)9-2/h10-16H,8-9H2,1-7H3/b12-11+,19-13-,21-15+,23-10+,24-17- |
| InChIKey | MUFMPXCETYUJLV-GKWHXLIDSA-N |
| XLogP | 7.60 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.99 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|