C20H24ClN5O2S — CID 163391408
(2E,3Z)-N-(5-amino-1,3,4-thiadiazol-2-yl)-3-(2-chloro-5-methoxy-4-pyridinyl)-2-ethylidene-5,6-dimethylocta-3,5-dienamide (PubChem CID 163391408) has the molecular formula C20H24ClN5O2S and a molecular weight of 433.97 g/mol. Its IUPAC name is (2E,3Z)-N-(5-amino-1,3,4-thiadiazol-2-yl)-3-(2-chloro-5-methoxy-4-pyridinyl)-2-ethylidene-5,6-dimethylocta-3,5-dienamide.
| Compound Name | (2E,3Z)-N-(5-amino-1,3,4-thiadiazol-2-yl)-3-(2-chloro-5-methoxy-4-pyridinyl)-2-ethylidene-5,6-dimethylocta-3,5-dienamide |
|---|---|
| PubChem CID | 163391408 |
| Molecular Formula | C20H24ClN5O2S |
| Molecular Weight | 433.97 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | (2E,3Z)-N-(5-amino-1,3,4-thiadiazol-2-yl)-3-(2-chloro-5-methoxy-4-pyridinyl)-2-ethylidene-5,6-dimethylocta-3,5-dienamide |
| SMILES | C/C=C(C(=O)Nc1nnc(N)s1)\C(=C/C(C)=C(C)CC)c1cc(Cl)ncc1OC |
| InChI | InChI=1S/C20H24ClN5O2S/c1-6-11(3)12(4)8-14(15-9-17(21)23-10-16(15)28-5)13(7-2)18(27)24-20-26-25-19(22)29-20/h7-10H,6H2,1-5H3,(H2,22,25)(H,24,26,27)/b12-11?,13-7+,14-8+ |
| InChIKey | IAYPZRQFXCTCAM-JLHCKESYSA-N |
| XLogP | 4.89 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.97 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|