C16H14ClN5O4S — CID 166162842
5-(2-chloro-5-methoxy-4-pyridinyl)-2-methoxy-N-(5-methoxy-1,3,4-thiadiazol-2-yl)pyridine-4-carboxamide (PubChem CID 166162842) has the molecular formula C16H14ClN5O4S and a molecular weight of 407.84 g/mol. Its IUPAC name is 5-(2-chloro-5-methoxy-4-pyridinyl)-2-methoxy-N-(5-methoxy-1,3,4-thiadiazol-2-yl)pyridine-4-carboxamide.
| Compound Name | 5-(2-chloro-5-methoxy-4-pyridinyl)-2-methoxy-N-(5-methoxy-1,3,4-thiadiazol-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 166162842 |
| Molecular Formula | C16H14ClN5O4S |
| Molecular Weight | 407.84 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 5-(2-chloro-5-methoxy-4-pyridinyl)-2-methoxy-N-(5-methoxy-1,3,4-thiadiazol-2-yl)pyridine-4-carboxamide |
| SMILES | COc1cc(C(=O)Nc2nnc(OC)s2)c(-c2cc(Cl)ncc2OC)cn1 |
| InChI | InChI=1S/C16H14ClN5O4S/c1-24-11-7-18-12(17)4-8(11)10-6-19-13(25-2)5-9(10)14(23)20-15-21-22-16(26-3)27-15/h4-7H,1-3H3,(H,20,21,23) |
| InChIKey | YAWKPBKUGKKAGN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.84 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|