C16H13ClN4O3S — CID 166163292
2-(2-chloro-5-methoxy-4-pyridinyl)-N-(5-methoxy-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 166163292) has the molecular formula C16H13ClN4O3S and a molecular weight of 376.83 g/mol. Its IUPAC name is 2-(2-chloro-5-methoxy-4-pyridinyl)-N-(5-methoxy-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 2-(2-chloro-5-methoxy-4-pyridinyl)-N-(5-methoxy-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 166163292 |
| Molecular Formula | C16H13ClN4O3S |
| Molecular Weight | 376.83 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 2-(2-chloro-5-methoxy-4-pyridinyl)-N-(5-methoxy-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | COc1nnc(NC(=O)c2ccccc2-c2cc(Cl)ncc2OC)s1 |
| InChI | InChI=1S/C16H13ClN4O3S/c1-23-12-8-18-13(17)7-11(12)9-5-3-4-6-10(9)14(22)19-15-20-21-16(24-2)25-15/h3-8H,1-2H3,(H,19,20,22) |
| InChIKey | DFRFNJAMKJDCBL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.83 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|