C28H36FN5O4S — CID 167102600
(E,2E)-4-amino-2-(aminomethylidene)-N-[5-[(2E,3Z,5E)-2-butan-2-ylidene-5-(2-hydroxypropan-2-yl)hepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-3-(2-fluoro-6-methoxyphenyl)but-3-enamide (PubChem CID 167102600) has the molecular formula C28H36FN5O4S and a molecular weight of 557.69 g/mol. Its IUPAC name is (E,2E)-4-amino-2-(aminomethylidene)-N-[5-[(2E,3Z,5E)-2-butan-2-ylidene-5-(2-hydroxypropan-2-yl)hepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-3-(2-fluoro-6-methoxyphenyl)but-3-enamide.
| Compound Name | (E,2E)-4-amino-2-(aminomethylidene)-N-[5-[(2E,3Z,5E)-2-butan-2-ylidene-5-(2-hydroxypropan-2-yl)hepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-3-(2-fluoro-6-methoxyphenyl)but-3-enamide |
|---|---|
| PubChem CID | 167102600 |
| Molecular Formula | C28H36FN5O4S |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | (E,2E)-4-amino-2-(aminomethylidene)-N-[5-[(2E,3Z,5E)-2-butan-2-ylidene-5-(2-hydroxypropan-2-yl)hepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-3-(2-fluoro-6-methoxyphenyl)but-3-enamide |
| SMILES | C/C=C(\C=C/C(COc1nnc(NC(=O)C(=C/N)/C(=C\N)c2c(F)cccc2OC)s1)=C(/C)CC)C(C)(C)O |
| InChI | InChI=1S/C28H36FN5O4S/c1-7-17(3)18(12-13-19(8-2)28(4,5)36)16-38-27-34-33-26(39-27)32-25(35)21(15-31)20(14-30)24-22(29)10-9-11-23(24)37-6/h8-15,36H,7,16,30-31H2,1-6H3,(H,32,33,35)/b13-12-,18-17+,19-8+,20-14+,21-15+ |
| InChIKey | IJFXJKYVRQVDKW-UCTBYBNQSA-N |
| XLogP | 4.85 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|