C29H33FN4O4S — CID 163390853
N-[5-[(2E,3Z,5E)-2-butan-2-ylidene-5-(1-hydroxyethyl)hepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-4-(2-fluoro-6-methoxyphenyl)-6-methylpyridine-3-carboxamide (PubChem CID 163390853) has the molecular formula C29H33FN4O4S and a molecular weight of 552.67 g/mol. Its IUPAC name is N-[5-[(2E,3Z,5E)-2-butan-2-ylidene-5-(1-hydroxyethyl)hepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-4-(2-fluoro-6-methoxyphenyl)-6-methylpyridine-3-carboxamide.
| Compound Name | N-[5-[(2E,3Z,5E)-2-butan-2-ylidene-5-(1-hydroxyethyl)hepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-4-(2-fluoro-6-methoxyphenyl)-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 163390853 |
| Molecular Formula | C29H33FN4O4S |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | N-[5-[(2E,3Z,5E)-2-butan-2-ylidene-5-(1-hydroxyethyl)hepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-4-(2-fluoro-6-methoxyphenyl)-6-methylpyridine-3-carboxamide |
| SMILES | C/C=C(\C=C/C(COc1nnc(NC(=O)c2cnc(C)cc2-c2c(F)cccc2OC)s1)=C(/C)CC)C(C)O |
| InChI | InChI=1S/C29H33FN4O4S/c1-7-17(3)21(13-12-20(8-2)19(5)35)16-38-29-34-33-28(39-29)32-27(36)23-15-31-18(4)14-22(23)26-24(30)10-9-11-25(26)37-6/h8-15,19,35H,7,16H2,1-6H3,(H,32,33,36)/b13-12-,20-8+,21-17+ |
| InChIKey | YQBJQLYKHBAEMG-LBJFFHGJSA-N |
| XLogP | 6.30 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|