C35H49N5O3S — CID 163391146
N-[5-[(3Z,5Z)-2-butan-2-ylidene-5-methylhepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-4-(5-methoxy-2-methyl-4-pyridinyl)-6-methylpyridine-3-carboxamide;2,3-dimethylpentane (PubChem CID 163391146) has the molecular formula C35H49N5O3S and a molecular weight of 619.88 g/mol. Its IUPAC name is N-[5-[(3Z,5Z)-2-butan-2-ylidene-5-methylhepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-4-(5-methoxy-2-methyl-4-pyridinyl)-6-methylpyridine-3-carboxamide;2,3-dimethylpentane.
| Compound Name | N-[5-[(3Z,5Z)-2-butan-2-ylidene-5-methylhepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-4-(5-methoxy-2-methyl-4-pyridinyl)-6-methylpyridine-3-carboxamide;2,3-dimethylpentane |
|---|---|
| PubChem CID | 163391146 |
| Molecular Formula | C35H49N5O3S |
| Molecular Weight | 619.88 g/mol |
| Exact Mass | 619.36 |
| IUPAC Name | N-[5-[(3Z,5Z)-2-butan-2-ylidene-5-methylhepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-4-(5-methoxy-2-methyl-4-pyridinyl)-6-methylpyridine-3-carboxamide;2,3-dimethylpentane |
| SMILES | C/C=C(C)\C=C/C(COc1nnc(NC(=O)c2cnc(C)cc2-c2cc(C)ncc2OC)s1)=C(C)CC.CCC(C)C(C)C |
| InChI | InChI=1S/C28H33N5O3S.C7H16/c1-8-17(3)10-11-21(18(4)9-2)16-36-28-33-32-27(37-28)31-26(34)24-14-29-19(5)12-22(24)23-13-20(6)30-15-25(23)35-7;1-5-7(4)6(2)3/h8,10-15H,9,16H2,1-7H3,(H,31,32,34);6-7H,5H2,1-4H3/b11-10-,17-8-,21-18?; |
| InChIKey | IZVYETGAYCROCI-XUSLDXMGSA-N |
| XLogP | 9.19 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.88 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|