C30H33FN4O5S — CID 167102725
N-[5-[(2E,3Z,5E)-2-butan-2-ylidene-5-(oxetan-3-yloxy)hepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-4-(2-fluoro-6-methoxyphenyl)-6-methylpyridine-3-carboxamide (PubChem CID 167102725) has the molecular formula C30H33FN4O5S and a molecular weight of 580.68 g/mol. Its IUPAC name is N-[5-[(2E,3Z,5E)-2-butan-2-ylidene-5-(oxetan-3-yloxy)hepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-4-(2-fluoro-6-methoxyphenyl)-6-methylpyridine-3-carboxamide.
| Compound Name | N-[5-[(2E,3Z,5E)-2-butan-2-ylidene-5-(oxetan-3-yloxy)hepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-4-(2-fluoro-6-methoxyphenyl)-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 167102725 |
| Molecular Formula | C30H33FN4O5S |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | N-[5-[(2E,3Z,5E)-2-butan-2-ylidene-5-(oxetan-3-yloxy)hepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-4-(2-fluoro-6-methoxyphenyl)-6-methylpyridine-3-carboxamide |
| SMILES | C/C=C(\C=C/C(COc1nnc(NC(=O)c2cnc(C)cc2-c2c(F)cccc2OC)s1)=C(/C)CC)OC1COC1 |
| InChI | InChI=1S/C30H33FN4O5S/c1-6-18(3)20(11-12-21(7-2)40-22-16-38-17-22)15-39-30-35-34-29(41-30)33-28(36)24-14-32-19(4)13-23(24)27-25(31)9-8-10-26(27)37-5/h7-14,22H,6,15-17H2,1-5H3,(H,33,34,36)/b12-11-,20-18+,21-7+ |
| InChIKey | GQKMREALKXOMOZ-TZJBAWCGSA-N |
| XLogP | 6.29 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|