C24H20FN5O5S — CID 170550576
N-[5-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-6-ylmethoxy)-1,3,4-thiadiazol-2-yl]-4-(2-fluoro-6-methoxyphenyl)-6-methylpyridine-3-carboxamide (PubChem CID 170550576) has the molecular formula C24H20FN5O5S and a molecular weight of 509.52 g/mol. Its IUPAC name is N-[5-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-6-ylmethoxy)-1,3,4-thiadiazol-2-yl]-4-(2-fluoro-6-methoxyphenyl)-6-methylpyridine-3-carboxamide.
| Compound Name | N-[5-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-6-ylmethoxy)-1,3,4-thiadiazol-2-yl]-4-(2-fluoro-6-methoxyphenyl)-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 170550576 |
| Molecular Formula | C24H20FN5O5S |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | N-[5-(2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-6-ylmethoxy)-1,3,4-thiadiazol-2-yl]-4-(2-fluoro-6-methoxyphenyl)-6-methylpyridine-3-carboxamide |
| SMILES | COc1cccc(F)c1-c1cc(C)ncc1C(=O)Nc1nnc(OCc2ccc3c(n2)OCCO3)s1 |
| InChI | InChI=1S/C24H20FN5O5S/c1-13-10-15(20-17(25)4-3-5-18(20)32-2)16(11-26-13)21(31)28-23-29-30-24(36-23)35-12-14-6-7-19-22(27-14)34-9-8-33-19/h3-7,10-11H,8-9,12H2,1-2H3,(H,28,29,31) |
| InChIKey | JGLKXDUREMUSBO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |