C30H37FN4O4S — CID 163391088
4-[(3E,5Z)-1-fluoro-3-methoxyhepta-1,3,5-trien-2-yl]-N-[5-[(3Z,5E)-5-(1-methoxyethyl)-2-propan-2-ylidenehepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-6-methylpyridine-3-carboxamide (PubChem CID 163391088) has the molecular formula C30H37FN4O4S and a molecular weight of 568.72 g/mol. Its IUPAC name is 4-[(3E,5Z)-1-fluoro-3-methoxyhepta-1,3,5-trien-2-yl]-N-[5-[(3Z,5E)-5-(1-methoxyethyl)-2-propan-2-ylidenehepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-6-methylpyridine-3-carboxamide.
| Compound Name | 4-[(3E,5Z)-1-fluoro-3-methoxyhepta-1,3,5-trien-2-yl]-N-[5-[(3Z,5E)-5-(1-methoxyethyl)-2-propan-2-ylidenehepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 163391088 |
| Molecular Formula | C30H37FN4O4S |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | 4-[(3E,5Z)-1-fluoro-3-methoxyhepta-1,3,5-trien-2-yl]-N-[5-[(3Z,5E)-5-(1-methoxyethyl)-2-propan-2-ylidenehepta-3,5-dienoxy]-1,3,4-thiadiazol-2-yl]-6-methylpyridine-3-carboxamide |
| SMILES | C/C=C\C=C(\OC)C(=CF)c1cc(C)ncc1C(=O)Nc1nnc(OCC(/C=C\C(=C/C)C(C)OC)=C(C)C)s1 |
| InChI | InChI=1S/C30H37FN4O4S/c1-9-11-12-27(38-8)25(16-31)24-15-20(5)32-17-26(24)28(36)33-29-34-35-30(40-29)39-18-23(19(3)4)14-13-22(10-2)21(6)37-7/h9-17,21H,18H2,1-8H3,(H,33,34,36)/b11-9-,14-13-,22-10+,25-16?,27-12+ |
| InChIKey | MGCQOQVOENKDGA-DBNADOAHSA-N |
| XLogP | 7.16 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|