C25H32N4O2 — CID 171555065
1-[7-[(2E,4Z,6Z)-4,7-dimethyl-6-propanoylnona-2,4,6-trien-3-yl]-2,6-naphthyridin-3-yl]-3-ethylurea (PubChem CID 171555065) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 1-[7-[(2E,4Z,6Z)-4,7-dimethyl-6-propanoylnona-2,4,6-trien-3-yl]-2,6-naphthyridin-3-yl]-3-ethylurea.
| Compound Name | 1-[7-[(2E,4Z,6Z)-4,7-dimethyl-6-propanoylnona-2,4,6-trien-3-yl]-2,6-naphthyridin-3-yl]-3-ethylurea |
|---|---|
| PubChem CID | 171555065 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 1-[7-[(2E,4Z,6Z)-4,7-dimethyl-6-propanoylnona-2,4,6-trien-3-yl]-2,6-naphthyridin-3-yl]-3-ethylurea |
| SMILES | C/C=C(C(\C)=C/C(C(=O)CC)=C(\C)CC)/c1cc2cnc(NC(=O)NCC)cc2cn1 |
| InChI | InChI=1S/C25H32N4O2/c1-7-16(5)21(23(30)9-3)11-17(6)20(8-2)22-12-18-15-28-24(13-19(18)14-27-22)29-25(31)26-10-4/h8,11-15H,7,9-10H2,1-6H3,(H2,26,28,29,31)/b17-11-,20-8+,21-16- |
| InChIKey | NLCJBTDWFPNKEF-VXCZIQDFSA-N |
| XLogP | 5.83 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|