C26H34N4O — CID 171556154
N-[7-[(E)-4-[(E)-3-methyloct-3-en-4-yl]iminopent-2-en-3-yl]-2,6-naphthyridin-3-yl]cyclopropanecarboxamide (PubChem CID 171556154) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is N-[7-[(E)-4-[(E)-3-methyloct-3-en-4-yl]iminopent-2-en-3-yl]-2,6-naphthyridin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[7-[(E)-4-[(E)-3-methyloct-3-en-4-yl]iminopent-2-en-3-yl]-2,6-naphthyridin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 171556154 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | N-[7-[(E)-4-[(E)-3-methyloct-3-en-4-yl]iminopent-2-en-3-yl]-2,6-naphthyridin-3-yl]cyclopropanecarboxamide |
| SMILES | C/C=C(C(\C)=N\C(CCCC)=C(/C)CC)/c1cc2cnc(NC(=O)C3CC3)cc2cn1 |
| InChI | InChI=1S/C26H34N4O/c1-6-9-10-23(17(4)7-2)29-18(5)22(8-3)24-13-20-16-28-25(14-21(20)15-27-24)30-26(31)19-11-12-19/h8,13-16,19H,6-7,9-12H2,1-5H3,(H,28,30,31)/b22-8+,23-17+,29-18+ |
| InChIKey | HGOJXOATWDQUJC-BUKKFVSWSA-N |
| XLogP | 6.72 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|