C13H12N2O2 — CID 67975011
N-(7-hydroxyisoquinolin-3-yl)cyclopropanecarboxamide (PubChem CID 67975011) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is N-(7-hydroxyisoquinolin-3-yl)cyclopropanecarboxamide.
| Compound Name | N-(7-hydroxyisoquinolin-3-yl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 67975011 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | N-(7-hydroxyisoquinolin-3-yl)cyclopropanecarboxamide |
| SMILES | O=C(Nc1cc2ccc(O)cc2cn1)C1CC1 |
| InChI | InChI=1S/C13H12N2O2/c16-11-4-3-9-6-12(14-7-10(9)5-11)15-13(17)8-1-2-8/h3-8,16H,1-2H2,(H,14,15,17) |
| InChIKey | PDLCYLLLINYRFA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |