C19H13FN4O — CID 57410357
N-[7-(2-cyano-5-fluoro-3-pyridinyl)isoquinolin-3-yl]cyclopropanecarboxamide (PubChem CID 57410357) has the molecular formula C19H13FN4O and a molecular weight of 332.34 g/mol. Its IUPAC name is N-[7-(2-cyano-5-fluoro-3-pyridinyl)isoquinolin-3-yl]cyclopropanecarboxamide.
| Compound Name | N-[7-(2-cyano-5-fluoro-3-pyridinyl)isoquinolin-3-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 57410357 |
| Molecular Formula | C19H13FN4O |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | N-[7-(2-cyano-5-fluoro-3-pyridinyl)isoquinolin-3-yl]cyclopropanecarboxamide |
| SMILES | N#Cc1ncc(F)cc1-c1ccc2cc(NC(=O)C3CC3)ncc2c1 |
| InChI | InChI=1S/C19H13FN4O/c20-15-7-16(17(8-21)22-10-15)13-4-3-12-6-18(23-9-14(12)5-13)24-19(25)11-1-2-11/h3-7,9-11H,1-2H2,(H,23,24,25) |
| InChIKey | WYUGFLWTSZRHGP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |