C21H19FN2O — CID 71134963
(1R)-N-[7-(5-fluoro-2-methylphenyl)isoquinolin-3-yl]-2-methylcyclopropane-1-carboxamide (PubChem CID 71134963) has the molecular formula C21H19FN2O and a molecular weight of 334.39 g/mol. Its IUPAC name is (1R)-N-[7-(5-fluoro-2-methylphenyl)isoquinolin-3-yl]-2-methylcyclopropane-1-carboxamide.
| Compound Name | (1R)-N-[7-(5-fluoro-2-methylphenyl)isoquinolin-3-yl]-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 71134963 |
| Molecular Formula | C21H19FN2O |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (1R)-N-[7-(5-fluoro-2-methylphenyl)isoquinolin-3-yl]-2-methylcyclopropane-1-carboxamide |
| SMILES | Cc1ccc(F)cc1-c1ccc2cc(NC(=O)[C@@H]3CC3C)ncc2c1 |
| InChI | InChI=1S/C21H19FN2O/c1-12-3-6-17(22)10-18(12)15-5-4-14-9-20(23-11-16(14)8-15)24-21(25)19-7-13(19)2/h3-6,8-11,13,19H,7H2,1-2H3,(H,23,24,25)/t13?,19-/m1/s1 |
| InChIKey | BKDVILNWHYFSDN-GAGCMDECSA-N |
| XLogP | 4.94 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |