C21H18F2N2 — CID 129170148
N-[1-(1-fluorocyclopropyl)ethenyl]-7-(5-fluoro-2-methylphenyl)isoquinolin-3-amine (PubChem CID 129170148) has the molecular formula C21H18F2N2 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-[1-(1-fluorocyclopropyl)ethenyl]-7-(5-fluoro-2-methylphenyl)isoquinolin-3-amine.
| Compound Name | N-[1-(1-fluorocyclopropyl)ethenyl]-7-(5-fluoro-2-methylphenyl)isoquinolin-3-amine |
|---|---|
| PubChem CID | 129170148 |
| Molecular Formula | C21H18F2N2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N-[1-(1-fluorocyclopropyl)ethenyl]-7-(5-fluoro-2-methylphenyl)isoquinolin-3-amine |
| SMILES | C=C(Nc1cc2ccc(-c3cc(F)ccc3C)cc2cn1)C1(F)CC1 |
| InChI | InChI=1S/C21H18F2N2/c1-13-3-6-18(22)11-19(13)16-5-4-15-10-20(24-12-17(15)9-16)25-14(2)21(23)7-8-21/h3-6,9-12H,2,7-8H2,1H3,(H,24,25) |
| InChIKey | JMNMBPBTLUYWOE-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |