C19H15ClFN3 — CID 129169917
7-(2-chloro-5-fluoro-3-pyridinyl)-N-(1-cyclopropylethenyl)isoquinolin-3-amine (PubChem CID 129169917) has the molecular formula C19H15ClFN3 and a molecular weight of 339.80 g/mol. Its IUPAC name is 7-(2-chloro-5-fluoro-3-pyridinyl)-N-(1-cyclopropylethenyl)isoquinolin-3-amine.
| Compound Name | 7-(2-chloro-5-fluoro-3-pyridinyl)-N-(1-cyclopropylethenyl)isoquinolin-3-amine |
|---|---|
| PubChem CID | 129169917 |
| Molecular Formula | C19H15ClFN3 |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 7-(2-chloro-5-fluoro-3-pyridinyl)-N-(1-cyclopropylethenyl)isoquinolin-3-amine |
| SMILES | C=C(Nc1cc2ccc(-c3cc(F)cnc3Cl)cc2cn1)C1CC1 |
| InChI | InChI=1S/C19H15ClFN3/c1-11(12-2-3-12)24-18-7-13-4-5-14(6-15(13)9-22-18)17-8-16(21)10-23-19(17)20/h4-10,12H,1-3H2,(H,22,24) |
| InChIKey | HSOUDSOSXBDDKM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|