C19H14ClF2N3O — CID 86674978
cis-(1S,2S)-N-[7-(6-chloro-5-fluoro-4-methyl-3-pyridinyl)isoquinolin-3-yl]-2-fluorocyclopropane-1-carboxamide (PubChem CID 86674978) has the molecular formula C19H14ClF2N3O and a molecular weight of 373.79 g/mol. Its IUPAC name is cis-(1S,2S)-N-[7-(6-chloro-5-fluoro-4-methyl-3-pyridinyl)isoquinolin-3-yl]-2-fluorocyclopropane-1-carboxamide.
| Compound Name | cis-(1S,2S)-N-[7-(6-chloro-5-fluoro-4-methyl-3-pyridinyl)isoquinolin-3-yl]-2-fluorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 86674978 |
| Molecular Formula | C19H14ClF2N3O |
| Molecular Weight | 373.79 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | cis-(1S,2S)-N-[7-(6-chloro-5-fluoro-4-methyl-3-pyridinyl)isoquinolin-3-yl]-2-fluorocyclopropane-1-carboxamide |
| SMILES | Cc1c(-c2ccc3cc(NC(=O)[C@@H]4C[C@@H]4F)ncc3c2)cnc(Cl)c1F |
| InChI | InChI=1S/C19H14ClF2N3O/c1-9-14(8-24-18(20)17(9)22)11-3-2-10-5-16(23-7-12(10)4-11)25-19(26)13-6-15(13)21/h2-5,7-8,13,15H,6H2,1H3,(H,23,25,26)/t13-,15+/m1/s1 |
| InChIKey | AQXTUFCXJLYJRT-HIFRSBDPSA-N |
| XLogP | 4.69 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.79 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|