About N-[1-(4,4-difluorocyclohexyl)ethenyl]-6-(3-methylimidazol-4-yl)isoquinolin-3-amine
N-[1-(4,4-difluorocyclohexyl)ethenyl]-6-(3-methylimidazol-4-yl)isoquinolin-3-amine (PubChem CID 166954633) has the molecular formula C21H22F2N4
and a molecular weight of 368.43 g/mol. Its IUPAC name is N-[1-(4,4-difluorocyclohexyl)ethenyl]-6-(3-methylimidazol-4-yl)isoquinolin-3-amine.
Molecular Properties
| Compound Name | N-[1-(4,4-difluorocyclohexyl)ethenyl]-6-(3-methylimidazol-4-yl)isoquinolin-3-amine |
| PubChem CID | 166954633 |
| Molecular Formula | C21H22F2N4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-[1-(4,4-difluorocyclohexyl)ethenyl]-6-(3-methylimidazol-4-yl)isoquinolin-3-amine |
| SMILES | C=C(Nc1cc2cc(-c3cncn3C)ccc2cn1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C21H22F2N4/c1-14(15-5-7-21(22,23)8-6-15)26-20-10-18-9-16(3-4-17(18)11-25-20)19-12-24-13-27(19)2/h3-4,9-13,15H,1,5-8H2,2H3,(H,25,26) |
| InChIKey | YIWHWLWKELMQPN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-(4,4-difluorocyclohexyl)ethenyl]-6-(3-methylimidazol-4-yl)isoquinolin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4,4-difluorocyclohexyl)ethenyl]-6-(3-methylimidazol-4-yl)isoquinolin-3-amine?
The IUPAC name of N-[1-(4,4-difluorocyclohexyl)ethenyl]-6-(3-methylimidazol-4-yl)isoquinolin-3-amine (CID 166954633) is N-[1-(4,4-difluorocyclohexyl)ethenyl]-6-(3-methylimidazol-4-yl)isoquinolin-3-amine.
What is the SMILES notation for N-[1-(4,4-difluorocyclohexyl)ethenyl]-6-(3-methylimidazol-4-yl)isoquinolin-3-amine?
The canonical SMILES for N-[1-(4,4-difluorocyclohexyl)ethenyl]-6-(3-methylimidazol-4-yl)isoquinolin-3-amine is C=C(Nc1cc2cc(-c3cncn3C)ccc2cn1)C1CCC(F)(F)CC1.
What is the InChIKey of N-[1-(4,4-difluorocyclohexyl)ethenyl]-6-(3-methylimidazol-4-yl)isoquinolin-3-amine?
The InChIKey is YIWHWLWKELMQPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22F2N4/c1-14(15-5-7-21(22,23)8-6-15)26-20-10-18-9-16(3-4-17(18)11-25-20)19-12-24-13-27(19)2/h3-4,9-13,15H,1,5-8H2,2H3,(H,25,26).
What are the key properties of N-[1-(4,4-difluorocyclohexyl)ethenyl]-6-(3-methylimidazol-4-yl)isoquinolin-3-amine?
N-[1-(4,4-difluorocyclohexyl)ethenyl]-6-(3-methylimidazol-4-yl)isoquinolin-3-amine has a molecular weight of 368.43 g/mol, XLogP of 5.39, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4,4-difluorocyclohexyl)ethenyl]-6-(3-methylimidazol-4-yl)isoquinolin-3-amine is sourced from PubChem (CID 166954633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).