C21H23N5O3 — CID 166687835
2-[4-[[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]carbamoyl]piperidin-1-yl]acetic acid (PubChem CID 166687835) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is 2-[4-[[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]carbamoyl]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]carbamoyl]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 166687835 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 2-[4-[[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]carbamoyl]piperidin-1-yl]acetic acid |
| SMILES | Cn1cncc1-c1ccc2cnc(NC(=O)C3CCN(CC(=O)O)CC3)cc2c1 |
| InChI | InChI=1S/C21H23N5O3/c1-25-13-22-11-18(25)15-2-3-16-10-23-19(9-17(16)8-15)24-21(29)14-4-6-26(7-5-14)12-20(27)28/h2-3,8-11,13-14H,4-7,12H2,1H3,(H,27,28)(H,23,24,29) |
| InChIKey | VGPKGJXAXVSMNW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |