C22H25N5S — CID 166702508
1-cyclopropyl-N-[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]piperidine-4-carbothioamide (PubChem CID 166702508) has the molecular formula C22H25N5S and a molecular weight of 391.54 g/mol. Its IUPAC name is 1-cyclopropyl-N-[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]piperidine-4-carbothioamide.
| Compound Name | 1-cyclopropyl-N-[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]piperidine-4-carbothioamide |
|---|---|
| PubChem CID | 166702508 |
| Molecular Formula | C22H25N5S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 1-cyclopropyl-N-[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]piperidine-4-carbothioamide |
| SMILES | Cn1cncc1-c1ccc2cnc(NC(=S)C3CCN(C4CC4)CC3)cc2c1 |
| InChI | InChI=1S/C22H25N5S/c1-26-14-23-13-20(26)16-2-3-17-12-24-21(11-18(17)10-16)25-22(28)15-6-8-27(9-7-15)19-4-5-19/h2-3,10-15,19H,4-9H2,1H3,(H,24,25,28) |
| InChIKey | VFBOPTUWBAEJPH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|