C21H18N4O — CID 155295664
4-methyl-N-[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]benzamide (PubChem CID 155295664) has the molecular formula C21H18N4O and a molecular weight of 342.40 g/mol. Its IUPAC name is 4-methyl-N-[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]benzamide.
| Compound Name | 4-methyl-N-[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]benzamide |
|---|---|
| PubChem CID | 155295664 |
| Molecular Formula | C21H18N4O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 4-methyl-N-[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cc3cc(-c4cncn4C)ccc3cn2)cc1 |
| InChI | InChI=1S/C21H18N4O/c1-14-3-5-15(6-4-14)21(26)24-20-10-18-9-16(7-8-17(18)11-23-20)19-12-22-13-25(19)2/h3-13H,1-2H3,(H,23,24,26) |
| InChIKey | RMEUSGONLFCGDF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |