C21H17FN4O4 — CID 138579889
5-fluoro-6-[1-[[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]amino]ethenyl]benzene-1,2,3,4-tetrol (PubChem CID 138579889) has the molecular formula C21H17FN4O4 and a molecular weight of 408.39 g/mol. Its IUPAC name is 5-fluoro-6-[1-[[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]amino]ethenyl]benzene-1,2,3,4-tetrol.
| Compound Name | 5-fluoro-6-[1-[[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]amino]ethenyl]benzene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 138579889 |
| Molecular Formula | C21H17FN4O4 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 5-fluoro-6-[1-[[6-(3-methylimidazol-4-yl)isoquinolin-3-yl]amino]ethenyl]benzene-1,2,3,4-tetrol |
| SMILES | C=C(Nc1cc2cc(-c3cncn3C)ccc2cn1)c1c(O)c(O)c(O)c(O)c1F |
| InChI | InChI=1S/C21H17FN4O4/c1-10(16-17(22)19(28)21(30)20(29)18(16)27)25-15-6-13-5-11(3-4-12(13)7-24-15)14-8-23-9-26(14)2/h3-9,27-30H,1H2,2H3,(H,24,25) |
| InChIKey | ILLPUDRQBFYJLK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|