C28H27B5N6OS — CID 142562796
CID 142562796 (PubChem CID 142562796) has the molecular formula C28H27B5N6OS and a molecular weight of 549.69 g/mol.
| Compound Name | CID 142562796 |
|---|---|
| PubChem CID | 142562796 |
| Molecular Formula | C28H27B5N6OS |
| Molecular Weight | 549.69 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | — |
| SMILES | [B]C1(C)N(c2cc(C(=C)Nc3cc4cc(-c5cncn5C)ccc4cn3)ccn2)C([B])(S)C([B])(C)C([B])([B])C1(C)O |
| InChI | InChI=1S/C28H27B5N6OS/c1-16(37-22-11-20-10-18(6-7-19(20)13-36-22)21-14-34-15-38(21)5)17-8-9-35-23(12-17)39-26(4,30)25(3,40)27(31,32)24(2,29)28(39,33)41/h6-15,40-41H,1H2,2-5H3,(H,36,37) |
| InChIKey | YOOFTQBVVXZZBM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.69 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|