C22H19N5 — CID 145392525
6-(3-methylimidazol-4-yl)-N-[1-(2-methyl-4-pyridinyl)cycloprop-2-en-1-yl]isoquinolin-3-amine (PubChem CID 145392525) has the molecular formula C22H19N5 and a molecular weight of 353.43 g/mol. Its IUPAC name is 6-(3-methylimidazol-4-yl)-N-[1-(2-methyl-4-pyridinyl)cycloprop-2-en-1-yl]isoquinolin-3-amine.
| Compound Name | 6-(3-methylimidazol-4-yl)-N-[1-(2-methyl-4-pyridinyl)cycloprop-2-en-1-yl]isoquinolin-3-amine |
|---|---|
| PubChem CID | 145392525 |
| Molecular Formula | C22H19N5 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 6-(3-methylimidazol-4-yl)-N-[1-(2-methyl-4-pyridinyl)cycloprop-2-en-1-yl]isoquinolin-3-amine |
| SMILES | Cc1cc(C2(Nc3cc4cc(-c5cncn5C)ccc4cn3)C=C2)ccn1 |
| InChI | InChI=1S/C22H19N5/c1-15-9-19(5-8-24-15)22(6-7-22)26-21-11-18-10-16(3-4-17(18)12-25-21)20-13-23-14-27(20)2/h3-14H,1-2H3,(H,25,26) |
| InChIKey | OHFNRNMJNZLGCO-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|