C28H32N4S — CID 153384560
2-[(1E)-buta-1,3-dienyl]-3,4,5,6-tetramethylbenzenethiol;N-methyl-6-(3-methylimidazol-4-yl)isoquinolin-3-amine (PubChem CID 153384560) has the molecular formula C28H32N4S and a molecular weight of 456.66 g/mol. Its IUPAC name is 2-[(1E)-buta-1,3-dienyl]-3,4,5,6-tetramethylbenzenethiol;N-methyl-6-(3-methylimidazol-4-yl)isoquinolin-3-amine.
| Compound Name | 2-[(1E)-buta-1,3-dienyl]-3,4,5,6-tetramethylbenzenethiol;N-methyl-6-(3-methylimidazol-4-yl)isoquinolin-3-amine |
|---|---|
| PubChem CID | 153384560 |
| Molecular Formula | C28H32N4S |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 2-[(1E)-buta-1,3-dienyl]-3,4,5,6-tetramethylbenzenethiol;N-methyl-6-(3-methylimidazol-4-yl)isoquinolin-3-amine |
| SMILES | C=C/C=C/c1c(C)c(C)c(C)c(C)c1S.CNc1cc2cc(-c3cncn3C)ccc2cn1 |
| InChI | InChI=1S/C14H14N4.C14H18S/c1-15-14-6-12-5-10(3-4-11(12)7-17-14)13-8-16-9-18(13)2;1-6-7-8-13-11(4)9(2)10(3)12(5)14(13)15/h3-9H,1-2H3,(H,15,17);6-8,15H,1H2,2-5H3/b;8-7+ |
| InChIKey | ZWDQHFVDAUXJFM-ILHSMLOTSA-N |
| XLogP | 7.09 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|