C28H29BN4 — CID 142562922
CID 142562922 (PubChem CID 142562922) has the molecular formula C28H29BN4 and a molecular weight of 432.38 g/mol.
| Compound Name | CID 142562922 |
|---|---|
| PubChem CID | 142562922 |
| Molecular Formula | C28H29BN4 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | — |
| SMILES | [B]c1c(C)c(C)c(C)c(C)c1/C=C/C(=C)Nc1cc2cc(-c3cnc(C)n3C)ccc2cn1 |
| InChI | InChI=1S/C28H29BN4/c1-16(8-11-25-19(4)17(2)18(3)20(5)28(25)29)32-27-13-24-12-22(9-10-23(24)14-31-27)26-15-30-21(6)33(26)7/h8-15H,1H2,2-7H3,(H,31,32)/b11-8+ |
| InChIKey | VYUDZEQBFCNPKJ-DHZHZOJOSA-N |
| XLogP | 5.61 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|