C20H17N5O — CID 158342850
2-[7-(3-methylimidazol-4-yl)quinazolin-2-yl]-1-(2-methyl-4-pyridinyl)ethanone (PubChem CID 158342850) has the molecular formula C20H17N5O and a molecular weight of 343.39 g/mol. Its IUPAC name is 2-[7-(3-methylimidazol-4-yl)quinazolin-2-yl]-1-(2-methyl-4-pyridinyl)ethanone.
| Compound Name | 2-[7-(3-methylimidazol-4-yl)quinazolin-2-yl]-1-(2-methyl-4-pyridinyl)ethanone |
|---|---|
| PubChem CID | 158342850 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-[7-(3-methylimidazol-4-yl)quinazolin-2-yl]-1-(2-methyl-4-pyridinyl)ethanone |
| SMILES | Cc1cc(C(=O)Cc2ncc3ccc(-c4cncn4C)cc3n2)ccn1 |
| InChI | InChI=1S/C20H17N5O/c1-13-7-15(5-6-22-13)19(26)9-20-23-10-16-4-3-14(8-17(16)24-20)18-11-21-12-25(18)2/h3-8,10-12H,9H2,1-2H3 |
| InChIKey | GRJFWCPJBQUBRG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |