C22H20F3N5O3 — CID 171556536
(1R)-N-[3-[6-[(E)-C-ethyl-N-hydroxycarbonimidoyl]-5-fluoro-4-methyl-3-pyridinyl]-1-methyl-2-oxo-1,6-naphthyridin-7-yl]-2,2-difluorocyclopropane-1-carboxamide (PubChem CID 171556536) has the molecular formula C22H20F3N5O3 and a molecular weight of 459.43 g/mol. Its IUPAC name is (1R)-N-[3-[6-[(E)-C-ethyl-N-hydroxycarbonimidoyl]-5-fluoro-4-methyl-3-pyridinyl]-1-methyl-2-oxo-1,6-naphthyridin-7-yl]-2,2-difluorocyclopropane-1-carboxamide.
| Compound Name | (1R)-N-[3-[6-[(E)-C-ethyl-N-hydroxycarbonimidoyl]-5-fluoro-4-methyl-3-pyridinyl]-1-methyl-2-oxo-1,6-naphthyridin-7-yl]-2,2-difluorocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 171556536 |
| Molecular Formula | C22H20F3N5O3 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | (1R)-N-[3-[6-[(E)-C-ethyl-N-hydroxycarbonimidoyl]-5-fluoro-4-methyl-3-pyridinyl]-1-methyl-2-oxo-1,6-naphthyridin-7-yl]-2,2-difluorocyclopropane-1-carboxamide |
| SMILES | CC/C(=N\O)c1ncc(-c2cc3cnc(NC(=O)[C@H]4CC4(F)F)cc3n(C)c2=O)c(C)c1F |
| InChI | InChI=1S/C22H20F3N5O3/c1-4-15(29-33)19-18(23)10(2)13(9-27-19)12-5-11-8-26-17(6-16(11)30(3)21(12)32)28-20(31)14-7-22(14,24)25/h5-6,8-9,14,33H,4,7H2,1-3H3,(H,26,28,31)/b29-15+/t14-/m1/s1 |
| InChIKey | MZXTVSCCQUDFFK-ZYULPCRLSA-N |
| XLogP | 3.63 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|