C23H24BFN4O3 — CID 166123464
CID 166123464 (PubChem CID 166123464) has the molecular formula C23H24BFN4O3 and a molecular weight of 434.28 g/mol.
| Compound Name | CID 166123464 |
|---|---|
| PubChem CID | 166123464 |
| Molecular Formula | C23H24BFN4O3 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | — |
| SMILES | [B]C(O)(CCC)c1cc(C)c(-c2cc3cnc(NC(=O)C4CC4F)cc3n(C)c2=O)cn1 |
| InChI | InChI=1S/C23H24BFN4O3/c1-4-5-23(24,32)19-6-12(2)16(11-26-19)14-7-13-10-27-20(9-18(13)29(3)22(14)31)28-21(30)15-8-17(15)25/h6-7,9-11,15,17,32H,4-5,8H2,1-3H3,(H,27,28,30) |
| InChIKey | BOCQBRJLJHMGCF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|