C12H8Br6N2 — CID 88686160
azane;2,4,6-tribromo-N-(2,4,6-tribromophenyl)aniline (PubChem CID 88686160) has the molecular formula C12H8Br6N2 and a molecular weight of 659.63 g/mol. Its IUPAC name is azane;2,4,6-tribromo-N-(2,4,6-tribromophenyl)aniline.
| Compound Name | azane;2,4,6-tribromo-N-(2,4,6-tribromophenyl)aniline |
|---|---|
| PubChem CID | 88686160 |
| Molecular Formula | C12H8Br6N2 |
| Molecular Weight | 659.63 g/mol |
| Exact Mass | 653.58 |
| IUPAC Name | azane;2,4,6-tribromo-N-(2,4,6-tribromophenyl)aniline |
| SMILES | Brc1cc(Br)c(Nc2c(Br)cc(Br)cc2Br)c(Br)c1.N |
| InChI | InChI=1S/C12H5Br6N.H3N/c13-5-1-7(15)11(8(16)2-5)19-12-9(17)3-6(14)4-10(12)18;/h1-4,19H;1H3 |
| InChIKey | VZDFYGNAFCPYST-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 47.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.63 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |