C9H9BrO2 — CID 84692353
3-bromo-2-hydroxy-4,6-dimethylbenzaldehyde (PubChem CID 84692353) has the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. Its IUPAC name is 3-bromo-2-hydroxy-4,6-dimethylbenzaldehyde.
| Compound Name | 3-bromo-2-hydroxy-4,6-dimethylbenzaldehyde |
|---|---|
| PubChem CID | 84692353 |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | 3-bromo-2-hydroxy-4,6-dimethylbenzaldehyde |
| SMILES | Cc1cc(C)c(C=O)c(O)c1Br |
| InChI | InChI=1S/C9H9BrO2/c1-5-3-6(2)8(10)9(12)7(5)4-11/h3-4,12H,1-2H3 |
| InChIKey | ABCSUGDNQYECJJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|