About 4-hydroxy-2,3,6-trimethylbenzaldehyde
4-hydroxy-2,3,6-trimethylbenzaldehyde (PubChem CID 11309702) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 4-hydroxy-2,3,6-trimethylbenzaldehyde.
Molecular Properties
| Compound Name | 4-hydroxy-2,3,6-trimethylbenzaldehyde |
| PubChem CID | 11309702 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 4-hydroxy-2,3,6-trimethylbenzaldehyde |
| SMILES | Cc1cc(O)c(C)c(C)c1C=O |
| InChI | InChI=1S/C10H12O2/c1-6-4-10(12)8(3)7(2)9(6)5-11/h4-5,12H,1-3H3 |
| InChIKey | JDNVQFCVWBDQPE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-2,3,6-trimethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,3,6-trimethylbenzaldehyde?
The IUPAC name of 4-hydroxy-2,3,6-trimethylbenzaldehyde (CID 11309702) is 4-hydroxy-2,3,6-trimethylbenzaldehyde.
What is the SMILES notation for 4-hydroxy-2,3,6-trimethylbenzaldehyde?
The canonical SMILES for 4-hydroxy-2,3,6-trimethylbenzaldehyde is Cc1cc(O)c(C)c(C)c1C=O.
What is the InChIKey of 4-hydroxy-2,3,6-trimethylbenzaldehyde?
The InChIKey is JDNVQFCVWBDQPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-6-4-10(12)8(3)7(2)9(6)5-11/h4-5,12H,1-3H3.
What are the key properties of 4-hydroxy-2,3,6-trimethylbenzaldehyde?
4-hydroxy-2,3,6-trimethylbenzaldehyde has a molecular weight of 164.20 g/mol, XLogP of 2.13, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,3,6-trimethylbenzaldehyde is sourced from PubChem (CID 11309702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).