C9H12BrClO — CID 175135355
5-bromo-2-methoxy-1,3-dimethylbenzene;hydrochloride (PubChem CID 175135355) has the molecular formula C9H12BrClO and a molecular weight of 251.55 g/mol. Its IUPAC name is 5-bromo-2-methoxy-1,3-dimethylbenzene;hydrochloride.
| Compound Name | 5-bromo-2-methoxy-1,3-dimethylbenzene;hydrochloride |
|---|---|
| PubChem CID | 175135355 |
| Molecular Formula | C9H12BrClO |
| Molecular Weight | 251.55 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | 5-bromo-2-methoxy-1,3-dimethylbenzene;hydrochloride |
| SMILES | COc1c(C)cc(Br)cc1C.Cl |
| InChI | InChI=1S/C9H11BrO.ClH/c1-6-4-8(10)5-7(2)9(6)11-3;/h4-5H,1-3H3;1H |
| InChIKey | FAOFJLIQLVWOCS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |