C16H16BrNO2 — CID 83068594
(3-amino-5-bromophenyl)-(4-methoxy-3,5-dimethylphenyl)methanone (PubChem CID 83068594) has the molecular formula C16H16BrNO2 and a molecular weight of 334.21 g/mol. Its IUPAC name is (3-amino-5-bromophenyl)-(4-methoxy-3,5-dimethylphenyl)methanone.
| Compound Name | (3-amino-5-bromophenyl)-(4-methoxy-3,5-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 83068594 |
| Molecular Formula | C16H16BrNO2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | (3-amino-5-bromophenyl)-(4-methoxy-3,5-dimethylphenyl)methanone |
| SMILES | COc1c(C)cc(C(=O)c2cc(N)cc(Br)c2)cc1C |
| InChI | InChI=1S/C16H16BrNO2/c1-9-4-11(5-10(2)16(9)20-3)15(19)12-6-13(17)8-14(18)7-12/h4-8H,18H2,1-3H3 |
| InChIKey | RTPABRUQFJCVAE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|