C9H8F5O4PS — CID 90222365
(2,3,4,5,6-pentafluorophenyl) dimethylphosphorylmethanesulfonate (PubChem CID 90222365) has the molecular formula C9H8F5O4PS and a molecular weight of 338.19 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) dimethylphosphorylmethanesulfonate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) dimethylphosphorylmethanesulfonate |
|---|---|
| PubChem CID | 90222365 |
| Molecular Formula | C9H8F5O4PS |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) dimethylphosphorylmethanesulfonate |
| SMILES | CP(C)(=O)CS(=O)(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H8F5O4PS/c1-19(2,15)3-20(16,17)18-9-7(13)5(11)4(10)6(12)8(9)14/h3H2,1-2H3 |
| InChIKey | PZWTUSYLXOAJBR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|