C20H28F5NO5S — CID 143985763
tert-butyl 2-[3-(2,3,4,5,6-pentafluorophenoxy)sulfonylpropyl]pyrrolidine-1-carboxylate;ethane (PubChem CID 143985763) has the molecular formula C20H28F5NO5S and a molecular weight of 489.50 g/mol. Its IUPAC name is tert-butyl 2-[3-(2,3,4,5,6-pentafluorophenoxy)sulfonylpropyl]pyrrolidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 2-[3-(2,3,4,5,6-pentafluorophenoxy)sulfonylpropyl]pyrrolidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 143985763 |
| Molecular Formula | C20H28F5NO5S |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | tert-butyl 2-[3-(2,3,4,5,6-pentafluorophenoxy)sulfonylpropyl]pyrrolidine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCCC1CCCS(=O)(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H22F5NO5S.C2H6/c1-18(2,3)28-17(25)24-8-4-6-10(24)7-5-9-30(26,27)29-16-14(22)12(20)11(19)13(21)15(16)23;1-2/h10H,4-9H2,1-3H3;1-2H3 |
| InChIKey | UJFXPYUAZXHLKJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|