C16H26F5NO4S — CID 123819636
tert-butyl 2-[2-(4,4,5,5,5-pentafluoropentylsulfonyl)ethyl]pyrrolidine-1-carboxylate (PubChem CID 123819636) has the molecular formula C16H26F5NO4S and a molecular weight of 423.44 g/mol. Its IUPAC name is tert-butyl 2-[2-(4,4,5,5,5-pentafluoropentylsulfonyl)ethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(4,4,5,5,5-pentafluoropentylsulfonyl)ethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123819636 |
| Molecular Formula | C16H26F5NO4S |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | tert-butyl 2-[2-(4,4,5,5,5-pentafluoropentylsulfonyl)ethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1CCS(=O)(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H26F5NO4S/c1-14(2,3)26-13(23)22-9-4-6-12(22)7-11-27(24,25)10-5-8-15(17,18)16(19,20)21/h12H,4-11H2,1-3H3 |
| InChIKey | PKTWZQYDJXUQAI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|