C13H28N2O2 — CID 166086054
tert-butyl 2-(methylaminomethyl)pyrrolidine-1-carboxylate;ethane (PubChem CID 166086054) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is tert-butyl 2-(methylaminomethyl)pyrrolidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 2-(methylaminomethyl)pyrrolidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 166086054 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | tert-butyl 2-(methylaminomethyl)pyrrolidine-1-carboxylate;ethane |
| SMILES | CC.CNCC1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22N2O2.C2H6/c1-11(2,3)15-10(14)13-7-5-6-9(13)8-12-4;1-2/h9,12H,5-8H2,1-4H3;1-2H3 |
| InChIKey | JTZGDLJZKNKNCL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |