C14H27N3O3 — CID 106638139
tert-butyl 2-[[[1-(methylamino)-1-oxopropan-2-yl]amino]methyl]pyrrolidine-1-carboxylate (PubChem CID 106638139) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is tert-butyl 2-[[[1-(methylamino)-1-oxopropan-2-yl]amino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[[1-(methylamino)-1-oxopropan-2-yl]amino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 106638139 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | tert-butyl 2-[[[1-(methylamino)-1-oxopropan-2-yl]amino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CNC(=O)C(C)NCC1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H27N3O3/c1-10(12(18)15-5)16-9-11-7-6-8-17(11)13(19)20-14(2,3)4/h10-11,16H,6-9H2,1-5H3,(H,15,18) |
| InChIKey | BFVWQNVZQKOOAC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |