C14H14F5NO5S — CID 87135944
3-[2-(2,3,4,5,6-pentafluorophenoxy)sulfonylethyl]piperidine-1-carboxylic acid (PubChem CID 87135944) has the molecular formula C14H14F5NO5S and a molecular weight of 403.33 g/mol. Its IUPAC name is 3-[2-(2,3,4,5,6-pentafluorophenoxy)sulfonylethyl]piperidine-1-carboxylic acid.
| Compound Name | 3-[2-(2,3,4,5,6-pentafluorophenoxy)sulfonylethyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87135944 |
| Molecular Formula | C14H14F5NO5S |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 3-[2-(2,3,4,5,6-pentafluorophenoxy)sulfonylethyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCCC(CCS(=O)(=O)Oc2c(F)c(F)c(F)c(F)c2F)C1 |
| InChI | InChI=1S/C14H14F5NO5S/c15-8-9(16)11(18)13(12(19)10(8)17)25-26(23,24)5-3-7-2-1-4-20(6-7)14(21)22/h7H,1-6H2,(H,21,22) |
| InChIKey | NPAKKWYAAYVKQF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|